C19H31N3O3 — CID 3863800
N-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]cyclohexanecarboxamide (PubChem CID 3863800) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]cyclohexanecarboxamide.
| Compound Name | N-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3863800 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]cyclohexanecarboxamide |
| SMILES | CC(C)CC1NC(=O)C2CC(NC(=O)C3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C19H31N3O3/c1-12(2)10-15-19(25)22-9-8-14(11-16(22)18(24)21-15)20-17(23)13-6-4-3-5-7-13/h12-16H,3-11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | VLZRQGSMTGIWRF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |