C19H25ClN4O3 — CID 56856643
1-[(3S,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chloro-2-methylphenyl)urea (PubChem CID 56856643) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chloro-2-methylphenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 56856643 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chloro-2-methylphenyl)urea |
| SMILES | Cc1cc(Cl)ccc1NC(=O)N[C@H]1C[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)N2C1 |
| InChI | InChI=1S/C19H25ClN4O3/c1-10(2)6-15-18(26)24-9-13(8-16(24)17(25)22-15)21-19(27)23-14-5-4-12(20)7-11(14)3/h4-5,7,10,13,15-16H,6,8-9H2,1-3H3,(H,22,25)(H2,21,23,27)/t13-,15-,16-/m0/s1 |
| InChIKey | FVXXNOHNEPFGII-BPUTZDHNSA-N |
| XLogP | 2.28 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |