C18H24ClN3O2 — CID 126461880
(3S,7S,8aS)-7-[(3-chlorophenyl)methylamino]-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126461880) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (3S,7S,8aS)-7-[(3-chlorophenyl)methylamino]-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-7-[(3-chlorophenyl)methylamino]-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126461880 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (3S,7S,8aS)-7-[(3-chlorophenyl)methylamino]-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H]2C[C@H](NCc3cccc(Cl)c3)CN2C1=O |
| InChI | InChI=1S/C18H24ClN3O2/c1-11(2)6-15-18(24)22-10-14(8-16(22)17(23)21-15)20-9-12-4-3-5-13(19)7-12/h3-5,7,11,14-16,20H,6,8-10H2,1-2H3,(H,21,23)/t14-,15-,16-/m0/s1 |
| InChIKey | CEHWCDOWVUGWED-JYJNAYRXSA-N |
| XLogP | 1.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |