C16H19ClN4O4 — CID 56852237
1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-chlorophenyl)urea (PubChem CID 56852237) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 56852237 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-chlorophenyl)urea |
| SMILES | C[C@H](O)[C@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3cccc(Cl)c3)CN2C1=O |
| InChI | InChI=1S/C16H19ClN4O4/c1-8(22)13-15(24)21-7-11(6-12(21)14(23)20-13)19-16(25)18-10-4-2-3-9(17)5-10/h2-5,8,11-13,22H,6-7H2,1H3,(H,20,23)(H2,18,19,25)/t8-,11-,12-,13+/m0/s1 |
| InChIKey | GKYMIMZSJJPUIA-ZBPZKIAKSA-N |
| XLogP | 0.31 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |