C17H20ClN3O3 — CID 56855758
N-[(3S,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-chlorobenzamide (PubChem CID 56855758) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-chlorobenzamide.
| Compound Name | N-[(3S,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 56855758 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[(3S,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-chlorobenzamide |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)c3ccc(Cl)cc3)CN2C1=O |
| InChI | InChI=1S/C17H20ClN3O3/c1-9(2)14-17(24)21-8-12(7-13(21)16(23)20-14)19-15(22)10-3-5-11(18)6-4-10/h3-6,9,12-14H,7-8H2,1-2H3,(H,19,22)(H,20,23)/t12-,13-,14-/m0/s1 |
| InChIKey | TWRFZWAVYCUOKO-IHRRRGAJSA-N |
| XLogP | 1.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |