C19H26N4O3 — CID 56856963
1-[(3R,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 56856963) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[(3R,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 56856963 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-[(3R,7S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H]2C[C@H](NC(=O)N[C@H](C)c3ccccc3)CN2C1=O |
| InChI | InChI=1S/C19H26N4O3/c1-11(2)16-18(25)23-10-14(9-15(23)17(24)22-16)21-19(26)20-12(3)13-7-5-4-6-8-13/h4-8,11-12,14-16H,9-10H2,1-3H3,(H,22,24)(H2,20,21,26)/t12-,14+,15+,16-/m1/s1 |
| InChIKey | NXUOZNFOQDFMJH-SYAUCNOPSA-N |
| XLogP | 1.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |