C15H21N3O2S — CID 126462043
(3S,7S,8aS)-3-propan-2-yl-7-(thiophen-2-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126462043) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (3S,7S,8aS)-3-propan-2-yl-7-(thiophen-2-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-3-propan-2-yl-7-(thiophen-2-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126462043 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (3S,7S,8aS)-3-propan-2-yl-7-(thiophen-2-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H]2C[C@H](NCc3cccs3)CN2C1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-9(2)13-15(20)18-8-10(6-12(18)14(19)17-13)16-7-11-4-3-5-21-11/h3-5,9-10,12-13,16H,6-8H2,1-2H3,(H,17,19)/t10-,12-,13-/m0/s1 |
| InChIKey | VQDHGKMETOTRJL-DRZSPHRISA-N |
| XLogP | 0.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |