C22H29N5O2 — CID 126461842
(3S,7S,8aS)-3-[(2S)-butan-2-yl]-7-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126461842) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (3S,7S,8aS)-3-[(2S)-butan-2-yl]-7-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-3-[(2S)-butan-2-yl]-7-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126461842 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3S,7S,8aS)-3-[(2S)-butan-2-yl]-7-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H]2C[C@H](NCc3cn(C)nc3-c3ccccc3)CN2C1=O |
| InChI | InChI=1S/C22H29N5O2/c1-4-14(2)19-22(29)27-13-17(10-18(27)21(28)24-19)23-11-16-12-26(3)25-20(16)15-8-6-5-7-9-15/h5-9,12,14,17-19,23H,4,10-11,13H2,1-3H3,(H,24,28)/t14-,17-,18-,19-/m0/s1 |
| InChIKey | KNSUOTKDCCSVOA-QZHFEQFPSA-N |
| XLogP | 1.69 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |