C15H17ClN4O3 — CID 56857871
1-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)urea (PubChem CID 56857871) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 56857871 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)urea |
| SMILES | C[C@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3ccc(Cl)cc3)CN2C1=O |
| InChI | InChI=1S/C15H17ClN4O3/c1-8-14(22)20-7-11(6-12(20)13(21)17-8)19-15(23)18-10-4-2-9(16)3-5-10/h2-5,8,11-12H,6-7H2,1H3,(H,17,21)(H2,18,19,23)/t8-,11+,12+/m1/s1 |
| InChIKey | LGODLPVKKSSXFX-ZHAHWJHGSA-N |
| XLogP | 0.95 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |