C16H18FN3O3 — CID 56853527
N-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide (PubChem CID 56853527) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 56853527 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2C[C@H]3C(=O)N[C@@H](C)C(=O)N3C2)cc1F |
| InChI | InChI=1S/C16H18FN3O3/c1-8-3-4-10(5-12(8)17)14(21)19-11-6-13-15(22)18-9(2)16(23)20(13)7-11/h3-5,9,11,13H,6-7H2,1-2H3,(H,18,22)(H,19,21)/t9-,11-,13-/m0/s1 |
| InChIKey | GKSFVSINBWWDMF-GAFUQQFSSA-N |
| XLogP | 0.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |