C22H18ClF4N3O3 — CID 56857533
N-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 56857533) has the molecular formula C22H18ClF4N3O3 and a molecular weight of 483.85 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 56857533 |
| Molecular Formula | C22H18ClF4N3O3 |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1C[C@H]2C(=O)N[C@@H](Cc3ccc(Cl)cc3)C(=O)N2C1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18ClF4N3O3/c23-13-4-1-11(2-5-13)7-17-21(33)30-10-14(9-18(30)20(32)29-17)28-19(31)12-3-6-16(24)15(8-12)22(25,26)27/h1-6,8,14,17-18H,7,9-10H2,(H,28,31)(H,29,32)/t14-,17-,18-/m0/s1 |
| InChIKey | GYSQCFPDIRTYDV-WBAXXEDZSA-N |
| XLogP | 2.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |