C19H18ClN3O4S — CID 56859544
N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-chlorothiophene-2-carboxamide (PubChem CID 56859544) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-chlorothiophene-2-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 56859544 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-chlorothiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N2C1)c1sccc1Cl |
| InChI | InChI=1S/C19H18ClN3O4S/c20-13-5-6-28-16(13)18(26)21-11-8-15-17(25)22-14(19(27)23(15)9-11)7-10-1-3-12(24)4-2-10/h1-6,11,14-15,24H,7-9H2,(H,21,26)(H,22,25)/t11-,14-,15-/m0/s1 |
| InChIKey | BPYMAMXCTHLWLN-CQDKDKBSSA-N |
| XLogP | 1.55 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |