C21H20ClFN4O3 — CID 126460867
1-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-fluorophenyl)urea (PubChem CID 126460867) has the molecular formula C21H20ClFN4O3 and a molecular weight of 430.87 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 126460867 |
| Molecular Formula | C21H20ClFN4O3 |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N[C@H]1C[C@H]2C(=O)N[C@@H](Cc3ccc(Cl)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C21H20ClFN4O3/c22-13-3-1-12(2-4-13)9-17-20(29)27-11-16(10-18(27)19(28)26-17)25-21(30)24-15-7-5-14(23)6-8-15/h1-8,16-18H,9-11H2,(H,26,28)(H2,24,25,30)/t16-,17-,18-/m0/s1 |
| InChIKey | QAVJYMFPIPIVLN-BZSNNMDCSA-N |
| XLogP | 2.31 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |