C23H25FN4O4 — CID 56859189
1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(5-fluoro-2-methylphenyl)urea (PubChem CID 56859189) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(5-fluoro-2-methylphenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(5-fluoro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 56859189 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(5-fluoro-2-methylphenyl)urea |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3C[C@H](NC(=O)Nc4cc(F)ccc4C)CN3C2=O)cc1 |
| InChI | InChI=1S/C23H25FN4O4/c1-13-3-6-15(24)10-18(13)27-23(31)25-16-11-20-21(29)26-19(22(30)28(20)12-16)9-14-4-7-17(32-2)8-5-14/h3-8,10,16,19-20H,9,11-12H2,1-2H3,(H,26,29)(H2,25,27,31)/t16-,19-,20-/m0/s1 |
| InChIKey | VRPAMUAIPVZHTK-VDGAXYAQSA-N |
| XLogP | 1.97 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |