C19H25N3O5 — CID 162806851
(2S)-N-[(3S,8R,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-hydroxypropanamide (PubChem CID 162806851) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is (2S)-N-[(3S,8R,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3S,8R,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 162806851 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2S)-N-[(3S,8R,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-hydroxypropanamide |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3C[C@H](NC(=O)[C@H](C)O)CCN3C2=O)cc1 |
| InChI | InChI=1S/C19H25N3O5/c1-11(23)17(24)20-13-7-8-22-16(10-13)18(25)21-15(19(22)26)9-12-3-5-14(27-2)6-4-12/h3-6,11,13,15-16,23H,7-10H2,1-2H3,(H,20,24)(H,21,25)/t11-,13+,15-,16-/m0/s1 |
| InChIKey | KJRHFAWHTASNTB-YOENINGUSA-N |
| XLogP | -0.41 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |