C20H25N3O7 — CID 163165483
2-[2-[[(3R,8S,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]amino]-2-oxoethoxy]acetic acid (PubChem CID 163165483) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-[2-[[(3R,8S,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3R,8S,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 163165483 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[2-[[(3R,8S,9aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]amino]-2-oxoethoxy]acetic acid |
| SMILES | COc1ccc(C[C@H]2NC(=O)[C@@H]3C[C@@H](NC(=O)COCC(=O)O)CCN3C2=O)cc1 |
| InChI | InChI=1S/C20H25N3O7/c1-29-14-4-2-12(3-5-14)8-15-20(28)23-7-6-13(9-16(23)19(27)22-15)21-17(24)10-30-11-18(25)26/h2-5,13,15-16H,6-11H2,1H3,(H,21,24)(H,22,27)(H,25,26)/t13-,15+,16-/m0/s1 |
| InChIKey | SOBYTZUIEMJQSI-IMJJTQAJSA-N |
| XLogP | -0.69 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |