C24H26FN3O4S — CID 7051109
N-[(3S,8S,9aS)-3-[(4-fluorophenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide (PubChem CID 7051109) has the molecular formula C24H26FN3O4S and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(3S,8S,9aS)-3-[(4-fluorophenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide.
| Compound Name | N-[(3S,8S,9aS)-3-[(4-fluorophenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 7051109 |
| Molecular Formula | C24H26FN3O4S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[(3S,8S,9aS)-3-[(4-fluorophenyl)methyl]-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide |
| SMILES | COc1cc(SC)ccc1C(=O)N[C@H]1CCN2C(=O)[C@H](Cc3ccc(F)cc3)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C24H26FN3O4S/c1-32-21-13-17(33-2)7-8-18(21)22(29)26-16-9-10-28-20(12-16)23(30)27-19(24(28)31)11-14-3-5-15(25)6-4-14/h3-8,13,16,19-20H,9-12H2,1-2H3,(H,26,29)(H,27,30)/t16-,19-,20-/m0/s1 |
| InChIKey | UOTWSSSWMNARGG-VDGAXYAQSA-N |
| XLogP | 2.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |