C20H20FN3O3S — CID 3771684
N-[1,4-dioxo-3-(thiophen-2-ylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3-fluorobenzamide (PubChem CID 3771684) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[1,4-dioxo-3-(thiophen-2-ylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3-fluorobenzamide.
| Compound Name | N-[1,4-dioxo-3-(thiophen-2-ylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 3771684 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[1,4-dioxo-3-(thiophen-2-ylmethyl)-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3-fluorobenzamide |
| SMILES | O=C(NC1CCN2C(=O)C(Cc3cccs3)NC(=O)C2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H20FN3O3S/c21-13-4-1-3-12(9-13)18(25)22-14-6-7-24-17(10-14)19(26)23-16(20(24)27)11-15-5-2-8-28-15/h1-5,8-9,14,16-17H,6-7,10-11H2,(H,22,25)(H,23,26) |
| InChIKey | LQZZERGVTIKFDN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |