C15H16BrN3O4 — CID 56856160
N-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-bromobenzamide (PubChem CID 56856160) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-bromobenzamide.
| Compound Name | N-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-bromobenzamide |
|---|---|
| PubChem CID | 56856160 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-bromobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2C(=O)N[C@H](CO)C(=O)N2C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16BrN3O4/c16-9-3-1-2-8(4-9)13(21)17-10-5-12-14(22)18-11(7-20)15(23)19(12)6-10/h1-4,10-12,20H,5-7H2,(H,17,21)(H,18,22)/t10-,11+,12-/m0/s1 |
| InChIKey | HPYIESSFTJBUMW-TUAOUCFPSA-N |
| XLogP | -0.36 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |