C22H22FN3O3 — CID 56859173
N-[(3R,7S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide (PubChem CID 56859173) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[(3R,7S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 56859173 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[(3R,7S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2C[C@H]3C(=O)N[C@H](Cc4ccccc4)C(=O)N3C2)cc1F |
| InChI | InChI=1S/C22H22FN3O3/c1-13-7-8-15(10-17(13)23)20(27)24-16-11-19-21(28)25-18(22(29)26(19)12-16)9-14-5-3-2-4-6-14/h2-8,10,16,18-19H,9,11-12H2,1H3,(H,24,27)(H,25,28)/t16-,18+,19-/m0/s1 |
| InChIKey | AJEZKVWEHKLRQU-UHOSZYNNSA-N |
| XLogP | 1.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |