C22H21F2N3O4 — CID 56857674
N-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,5-difluorobenzamide (PubChem CID 56857674) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,5-difluorobenzamide.
| Compound Name | N-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 56857674 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,5-difluorobenzamide |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3C[C@H](NC(=O)c4cc(F)ccc4F)CN3C2=O)cc1 |
| InChI | InChI=1S/C22H21F2N3O4/c1-31-15-5-2-12(3-6-15)8-18-22(30)27-11-14(10-19(27)21(29)26-18)25-20(28)16-9-13(23)4-7-17(16)24/h2-7,9,14,18-19H,8,10-11H2,1H3,(H,25,28)(H,26,29)/t14-,18-,19-/m0/s1 |
| InChIKey | JFYOFJZETXBXEK-JVPBZIDWSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |