C22H23FN4O4 — CID 56859773
1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea (PubChem CID 56859773) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 56859773 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-[(4-methoxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3C[C@H](NC(=O)Nc4ccccc4F)CN3C2=O)cc1 |
| InChI | InChI=1S/C22H23FN4O4/c1-31-15-8-6-13(7-9-15)10-18-21(29)27-12-14(11-19(27)20(28)25-18)24-22(30)26-17-5-3-2-4-16(17)23/h2-9,14,18-19H,10-12H2,1H3,(H,25,28)(H2,24,26,30)/t14-,18-,19-/m0/s1 |
| InChIKey | FYFGMVGLXHDCQS-JVPBZIDWSA-N |
| XLogP | 1.67 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |