C22H21F3N4O4 — CID 56854674
1-[(3R,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 56854674) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 56854674 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N[C@H]1C[C@H]2C(=O)N[C@H](Cc3ccc(O)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C22H21F3N4O4/c23-22(24,25)13-3-5-14(6-4-13)26-21(33)27-15-10-18-19(31)28-17(20(32)29(18)11-15)9-12-1-7-16(30)8-2-12/h1-8,15,17-18,30H,9-11H2,(H,28,31)(H2,26,27,33)/t15-,17+,18-/m0/s1 |
| InChIKey | FZZQDPSSYKCSEF-JQHSSLGASA-N |
| XLogP | 2.24 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |