C21H19Cl2N3O4 — CID 56853856
N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,6-dichlorobenzamide (PubChem CID 56853856) has the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.31 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 56853856 |
| Molecular Formula | C21H19Cl2N3O4 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2,6-dichlorobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N2C1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H19Cl2N3O4/c22-14-2-1-3-15(23)18(14)20(29)24-12-9-17-19(28)25-16(21(30)26(17)10-12)8-11-4-6-13(27)7-5-11/h1-7,12,16-17,27H,8-10H2,(H,24,29)(H,25,28)/t12-,16-,17-/m0/s1 |
| InChIKey | CJPCCZFPRDHCFU-ZLIFDBKOSA-N |
| XLogP | 2.14 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |