C16H17F3N4O3 — CID 56859332
1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 56859332) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 56859332 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | C[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3ccc(C(F)(F)F)cc3)CN2C1=O |
| InChI | InChI=1S/C16H17F3N4O3/c1-8-14(25)23-7-11(6-12(23)13(24)20-8)22-15(26)21-10-4-2-9(3-5-10)16(17,18)19/h2-5,8,11-12H,6-7H2,1H3,(H,20,24)(H2,21,22,26)/t8-,11-,12-/m0/s1 |
| InChIKey | ZQHPECHHROULAP-UWJYBYFXSA-N |
| XLogP | 1.31 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |