C19H20N4O3 — CID 126462056
1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-naphthalen-1-ylurea (PubChem CID 126462056) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 126462056 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-naphthalen-1-ylurea |
| SMILES | C[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3cccc4ccccc34)CN2C1=O |
| InChI | InChI=1S/C19H20N4O3/c1-11-18(25)23-10-13(9-16(23)17(24)20-11)21-19(26)22-15-8-4-6-12-5-2-3-7-14(12)15/h2-8,11,13,16H,9-10H2,1H3,(H,20,24)(H2,21,22,26)/t11-,13-,16-/m0/s1 |
| InChIKey | FFNOWBWTBXJTMV-RBOXIYTFSA-N |
| XLogP | 1.45 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |