C16H17F3N4O4 — CID 56855446
1-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 56855446) has the molecular formula C16H17F3N4O4 and a molecular weight of 386.33 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 56855446 |
| Molecular Formula | C16H17F3N4O4 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-(hydroxymethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N[C@H]1C[C@H]2C(=O)N[C@H](CO)C(=O)N2C1 |
| InChI | InChI=1S/C16H17F3N4O4/c17-16(18,19)9-3-1-2-4-10(9)22-15(27)20-8-5-12-13(25)21-11(7-24)14(26)23(12)6-8/h1-4,8,11-12,24H,5-7H2,(H,21,25)(H2,20,22,27)/t8-,11+,12-/m0/s1 |
| InChIKey | QJFOLKAMQHPYPY-AXTRIDKLSA-N |
| XLogP | 0.29 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |