C19H25N3O4S — CID 11867119
N-[(3S,8S,9aS)-3-ethyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide (PubChem CID 11867119) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[(3S,8S,9aS)-3-ethyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide.
| Compound Name | N-[(3S,8S,9aS)-3-ethyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 11867119 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[(3S,8S,9aS)-3-ethyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-methoxy-4-methylsulfanylbenzamide |
| SMILES | CC[C@@H]1NC(=O)[C@@H]2C[C@@H](NC(=O)c3ccc(SC)cc3OC)CCN2C1=O |
| InChI | InChI=1S/C19H25N3O4S/c1-4-14-19(25)22-8-7-11(9-15(22)18(24)21-14)20-17(23)13-6-5-12(27-3)10-16(13)26-2/h5-6,10-11,14-15H,4,7-9H2,1-3H3,(H,20,23)(H,21,24)/t11-,14-,15-/m0/s1 |
| InChIKey | LNYJRJIXJKUQKT-CQDKDKBSSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |