C24H28N4O4 — CID 56860697
1-[(3S,7S,8aS)-1,4-dioxo-3-(phenylmethoxymethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,4-dimethylphenyl)urea (PubChem CID 56860697) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-1,4-dioxo-3-(phenylmethoxymethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-1,4-dioxo-3-(phenylmethoxymethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 56860697 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[(3S,7S,8aS)-1,4-dioxo-3-(phenylmethoxymethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C[C@H]3C(=O)N[C@@H](COCc4ccccc4)C(=O)N3C2)cc1C |
| InChI | InChI=1S/C24H28N4O4/c1-15-8-9-18(10-16(15)2)25-24(31)26-19-11-21-22(29)27-20(23(30)28(21)12-19)14-32-13-17-6-4-3-5-7-17/h3-10,19-21H,11-14H2,1-2H3,(H,27,29)(H2,25,26,31)/t19-,20-,21-/m0/s1 |
| InChIKey | RMLRLLMXXGAGGW-ACRUOGEOSA-N |
| XLogP | 2.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |