C18H24FN5O3 — CID 56858348
1-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-fluorophenyl)urea (PubChem CID 56858348) has the molecular formula C18H24FN5O3 and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 56858348 |
| Molecular Formula | C18H24FN5O3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3-fluorophenyl)urea |
| SMILES | NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3cccc(F)c3)CN2C1=O |
| InChI | InChI=1S/C18H24FN5O3/c19-11-4-3-5-12(8-11)21-18(27)22-13-9-15-16(25)23-14(6-1-2-7-20)17(26)24(15)10-13/h3-5,8,13-15H,1-2,6-7,9-10,20H2,(H,23,25)(H2,21,22,27)/t13-,14-,15-/m0/s1 |
| InChIKey | GOMOPQKFQBPTRG-KKUMJFAQSA-N |
| XLogP | 0.54 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|