C18H24F2N4O2 — CID 56856138
(3S,7S,8aS)-3-(4-aminobutyl)-7-[(2,4-difluorophenyl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 56856138) has the molecular formula C18H24F2N4O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is (3S,7S,8aS)-3-(4-aminobutyl)-7-[(2,4-difluorophenyl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-3-(4-aminobutyl)-7-[(2,4-difluorophenyl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 56856138 |
| Molecular Formula | C18H24F2N4O2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3S,7S,8aS)-3-(4-aminobutyl)-7-[(2,4-difluorophenyl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](NCc3ccc(F)cc3F)CN2C1=O |
| InChI | InChI=1S/C18H24F2N4O2/c19-12-5-4-11(14(20)7-12)9-22-13-8-16-17(25)23-15(3-1-2-6-21)18(26)24(16)10-13/h4-5,7,13,15-16,22H,1-3,6,8-10,21H2,(H,23,25)/t13-,15-,16-/m0/s1 |
| InChIKey | KDRCIJWWJYAOHH-BPUTZDHNSA-N |
| XLogP | 0.65 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|