C20H28N4O3 — CID 126461486
1-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,5-dimethylphenyl)urea (PubChem CID 126461486) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 126461486 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)N[C@H]2C[C@H]3C(=O)N[C@H](CC(C)C)C(=O)N3C2)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-11(2)5-16-19(26)24-10-15(9-17(24)18(25)23-16)22-20(27)21-14-7-12(3)6-13(4)8-14/h6-8,11,15-17H,5,9-10H2,1-4H3,(H,23,25)(H2,21,22,27)/t15-,16+,17-/m0/s1 |
| InChIKey | SYEYUGMZBSHQDA-BBWFWOEESA-N |
| XLogP | 1.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |