C19H20N4O3 — CID 3864330
N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 3864330) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3864330 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC1CCN2C(=O)c3ccccc3NC(=O)C2C1 |
| InChI | InChI=1S/C19H20N4O3/c1-22-9-4-7-15(22)17(24)20-12-8-10-23-16(11-12)18(25)21-14-6-3-2-5-13(14)19(23)26/h2-7,9,12,16H,8,10-11H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | RUFSHIPUPZLTPL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |