C27H25N3O3 — CID 11942804
N-[(6aS,8S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]benzamide (PubChem CID 11942804) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]benzamide.
| Compound Name | N-[(6aS,8S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]benzamide |
|---|---|
| PubChem CID | 11942804 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(6aS,8S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]benzamide |
| SMILES | Cc1cccc(-c2ccc3c(c2)C(=O)N2C[C@@H](NC(=O)c4ccccc4)C[C@H]2C(=O)N3)c1C |
| InChI | InChI=1S/C27H25N3O3/c1-16-7-6-10-21(17(16)2)19-11-12-23-22(13-19)27(33)30-15-20(14-24(30)26(32)29-23)28-25(31)18-8-4-3-5-9-18/h3-13,20,24H,14-15H2,1-2H3,(H,28,31)(H,29,32)/t20-,24-/m0/s1 |
| InChIKey | SDWKNEYQYCEMHP-RDPSFJRHSA-N |
| XLogP | 3.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |