C24H29N4O3+ — CID 11943255
[2-[[(6aS,8S)-2-(2,3-dimethylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium (PubChem CID 11943255) has the molecular formula C24H29N4O3+ and a molecular weight of 421.52 g/mol. Its IUPAC name is [2-[[(6aS,8S)-2-(2,3-dimethylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium.
| Compound Name | [2-[[(6aS,8S)-2-(2,3-dimethylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 11943255 |
| Molecular Formula | C24H29N4O3+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [2-[[(6aS,8S)-2-(2,3-dimethylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
| SMILES | C[NH2+]CC(=O)N[C@H]1CCN2C(=O)c3cc(-c4cccc(C)c4C)ccc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C24H28N4O3/c1-14-5-4-6-18(15(14)2)16-7-8-20-19(11-16)24(31)28-10-9-17(26-22(29)13-25-3)12-21(28)23(30)27-20/h4-8,11,17,21,25H,9-10,12-13H2,1-3H3,(H,26,29)(H,27,30)/p+1/t17-,21-/m0/s1 |
| InChIKey | CWCLCLOSYQHRGB-UWJYYQICSA-O |
| XLogP | 1.21 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |