C24H27N3O5S — CID 3697000
N-[2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide (PubChem CID 3697000) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 3697000 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-methylsulfanylacetamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCC(NC(=O)CSC)CC2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-31-16-5-6-17(21(12-16)32-2)14-4-7-19-18(10-14)24(30)27-9-8-15(25-22(28)13-33-3)11-20(27)23(29)26-19/h4-7,10,12,15,20H,8-9,11,13H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | CPKDQJCZIQCXAV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |