C21H23N3O6S — CID 11942686
N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide (PubChem CID 11942686) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide.
| Compound Name | N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 11942686 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2C[C@@H](NS(C)(=O)=O)C[C@H]2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O6S/c1-29-14-5-6-15(19(10-14)30-2)12-4-7-17-16(8-12)21(26)24-11-13(23-31(3,27)28)9-18(24)20(25)22-17/h4-8,10,13,18,23H,9,11H2,1-3H3,(H,22,25)/t13-,18-/m0/s1 |
| InChIKey | MHYNCDYSGVMAHZ-UGSOOPFHSA-N |
| XLogP | 1.46 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |