C26H31N3O4S — CID 163128738
N-[2-[2-(4-tert-butylphenyl)ethenyl]-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide (PubChem CID 163128738) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[2-[2-(4-tert-butylphenyl)ethenyl]-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide.
| Compound Name | N-[2-[2-(4-tert-butylphenyl)ethenyl]-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 163128738 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[2-[2-(4-tert-butylphenyl)ethenyl]-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
| SMILES | CC(C)(C)c1ccc(C=Cc2ccc3c(c2)C(=O)N2CCC(NS(C)(=O)=O)CC2C(=O)N3)cc1 |
| InChI | InChI=1S/C26H31N3O4S/c1-26(2,3)19-10-7-17(8-11-19)5-6-18-9-12-22-21(15-18)25(31)29-14-13-20(28-34(4,32)33)16-23(29)24(30)27-22/h5-12,15,20,23,28H,13-14,16H2,1-4H3,(H,27,30) |
| InChIKey | FHVFJLITTPYWDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|