C22H25N3O6S — CID 11943253
N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide (PubChem CID 11943253) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide.
| Compound Name | N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 11943253 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]methanesulfonamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CC[C@H](NS(C)(=O)=O)C[C@H]2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C22H25N3O6S/c1-30-15-5-6-16(20(12-15)31-2)13-4-7-18-17(10-13)22(27)25-9-8-14(24-32(3,28)29)11-19(25)21(26)23-18/h4-7,10,12,14,19,24H,8-9,11H2,1-3H3,(H,23,26)/t14-,19-/m0/s1 |
| InChIKey | YOYPFHLDEIKOKU-LIRRHRJNSA-N |
| XLogP | 1.85 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |