C24H26N4O3S2 — CID 11882905
(4R)-N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-1,3-thiazolidine-4-carboxamide (PubChem CID 11882905) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (4R)-N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 11882905 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (4R)-N-[(6aS,8S)-2-(4-methylsulfanylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CSc1ccc(-c2ccc3c(c2)C(=O)N2CC[C@H](NC(=O)[C@@H]4CSCN4)C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-32-17-5-2-14(3-6-17)15-4-7-19-18(10-15)24(31)28-9-8-16(11-21(28)23(30)27-19)26-22(29)20-12-33-13-25-20/h2-7,10,16,20-21,25H,8-9,11-13H2,1H3,(H,26,29)(H,27,30)/t16-,20-,21-/m0/s1 |
| InChIKey | DQYZEESGENUTTL-NDXORKPFSA-N |
| XLogP | 2.78 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |