C16H11ClN2O4 — CID 11616901
7-chloro-3-methyl-3-(4-nitrophenyl)-1H-quinoline-2,4-dione (PubChem CID 11616901) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is 7-chloro-3-methyl-3-(4-nitrophenyl)-1H-quinoline-2,4-dione.
| Compound Name | 7-chloro-3-methyl-3-(4-nitrophenyl)-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 11616901 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 7-chloro-3-methyl-3-(4-nitrophenyl)-1H-quinoline-2,4-dione |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)C(=O)Nc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C16H11ClN2O4/c1-16(9-2-5-11(6-3-9)19(22)23)14(20)12-7-4-10(17)8-13(12)18-15(16)21/h2-8H,1H3,(H,18,21) |
| InChIKey | VXWWKNIPIKTJAE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|