C23H19ClN2O3 — CID 134463034
3-(4-chlorophenyl)-3,5-dimethyl-2-[(4-nitrophenyl)methyl]isoindol-1-one (PubChem CID 134463034) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3,5-dimethyl-2-[(4-nitrophenyl)methyl]isoindol-1-one.
| Compound Name | 3-(4-chlorophenyl)-3,5-dimethyl-2-[(4-nitrophenyl)methyl]isoindol-1-one |
|---|---|
| PubChem CID | 134463034 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-(4-chlorophenyl)-3,5-dimethyl-2-[(4-nitrophenyl)methyl]isoindol-1-one |
| SMILES | Cc1ccc2c(c1)C(C)(c1ccc(Cl)cc1)N(Cc1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C23H19ClN2O3/c1-15-3-12-20-21(13-15)23(2,17-6-8-18(24)9-7-17)25(22(20)27)14-16-4-10-19(11-5-16)26(28)29/h3-13H,14H2,1-2H3 |
| InChIKey | WWXHDGAYYKUNTF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|