C23H20ClNO2 — CID 118601659
3-(4-chlorophenyl)-3-hydroxy-6-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one (PubChem CID 118601659) has the molecular formula C23H20ClNO2 and a molecular weight of 377.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-hydroxy-6-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one.
| Compound Name | 3-(4-chlorophenyl)-3-hydroxy-6-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one |
|---|---|
| PubChem CID | 118601659 |
| Molecular Formula | C23H20ClNO2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(4-chlorophenyl)-3-hydroxy-6-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one |
| SMILES | Cc1ccc(CN2C(=O)c3cc(C)ccc3C2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClNO2/c1-15-3-6-17(7-4-15)14-25-22(26)20-13-16(2)5-12-21(20)23(25,27)18-8-10-19(24)11-9-18/h3-13,27H,14H2,1-2H3 |
| InChIKey | QVJKVBLUUXJZKZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |