C22H14BrClN2O2 — CID 135281608
4-[[5-bromo-1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzonitrile (PubChem CID 135281608) has the molecular formula C22H14BrClN2O2 and a molecular weight of 453.72 g/mol. Its IUPAC name is 4-[[5-bromo-1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-bromo-1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 135281608 |
| Molecular Formula | C22H14BrClN2O2 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 4-[[5-bromo-1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)c3cc(Br)ccc3C2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H14BrClN2O2/c23-17-7-10-20-19(11-17)21(27)26(13-15-3-1-14(12-25)2-4-15)22(20,28)16-5-8-18(24)9-6-16/h1-11,28H,13H2 |
| InChIKey | XGSNMSATTVHCRM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |