C21H14BrCl2NO — CID 51351393
2-[(4-bromophenyl)methyl]-3-chloro-3-(4-chlorophenyl)isoindol-1-one (PubChem CID 51351393) has the molecular formula C21H14BrCl2NO and a molecular weight of 447.16 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-3-chloro-3-(4-chlorophenyl)isoindol-1-one.
| Compound Name | 2-[(4-bromophenyl)methyl]-3-chloro-3-(4-chlorophenyl)isoindol-1-one |
|---|---|
| PubChem CID | 51351393 |
| Molecular Formula | C21H14BrCl2NO |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-3-chloro-3-(4-chlorophenyl)isoindol-1-one |
| SMILES | O=C1c2ccccc2C(Cl)(c2ccc(Cl)cc2)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H14BrCl2NO/c22-16-9-5-14(6-10-16)13-25-20(26)18-3-1-2-4-19(18)21(25,24)15-7-11-17(23)12-8-15/h1-12H,13H2 |
| InChIKey | PJTIFMGMWJEDRG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|