C23H20ClNO — CID 134463019
3-(4-chlorophenyl)-3-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one (PubChem CID 134463019) has the molecular formula C23H20ClNO and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one.
| Compound Name | 3-(4-chlorophenyl)-3-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one |
|---|---|
| PubChem CID | 134463019 |
| Molecular Formula | C23H20ClNO |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(4-chlorophenyl)-3-methyl-2-[(4-methylphenyl)methyl]isoindol-1-one |
| SMILES | Cc1ccc(CN2C(=O)c3ccccc3C2(C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClNO/c1-16-7-9-17(10-8-16)15-25-22(26)20-5-3-4-6-21(20)23(25,2)18-11-13-19(24)14-12-18/h3-14H,15H2,1-2H3 |
| InChIKey | HWNRIVJYGFWAGV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |