C26H25ClN2O5 — CID 44595459
3-(4-chlorophenyl)-3-(4-hydroxybutoxy)-2-[2-(4-nitrophenyl)ethyl]isoindol-1-one (PubChem CID 44595459) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(4-hydroxybutoxy)-2-[2-(4-nitrophenyl)ethyl]isoindol-1-one.
| Compound Name | 3-(4-chlorophenyl)-3-(4-hydroxybutoxy)-2-[2-(4-nitrophenyl)ethyl]isoindol-1-one |
|---|---|
| PubChem CID | 44595459 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(4-hydroxybutoxy)-2-[2-(4-nitrophenyl)ethyl]isoindol-1-one |
| SMILES | O=C1c2ccccc2C(OCCCCO)(c2ccc(Cl)cc2)N1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25ClN2O5/c27-21-11-9-20(10-12-21)26(34-18-4-3-17-30)24-6-2-1-5-23(24)25(31)28(26)16-15-19-7-13-22(14-8-19)29(32)33/h1-2,5-14,30H,3-4,15-18H2 |
| InChIKey | RKRLKEJLWMFRQZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|