C9H8ClNO2 — CID 142095055
6-chloro-1,2-dihydroquinoline-2,4-diol (PubChem CID 142095055) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-1,2-dihydroquinoline-2,4-diol.
| Compound Name | 6-chloro-1,2-dihydroquinoline-2,4-diol |
|---|---|
| PubChem CID | 142095055 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-chloro-1,2-dihydroquinoline-2,4-diol |
| SMILES | OC1=CC(O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H8ClNO2/c10-5-1-2-7-6(3-5)8(12)4-9(13)11-7/h1-4,9,11-13H |
| InChIKey | HISAMHIPEWHADR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |