C10H12ClN — CID 95430074
(2R,3R)-5-chloro-2,3-dimethyl-2,3-dihydro-1H-indole (PubChem CID 95430074) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is (2R,3R)-5-chloro-2,3-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | (2R,3R)-5-chloro-2,3-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 95430074 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (2R,3R)-5-chloro-2,3-dimethyl-2,3-dihydro-1H-indole |
| SMILES | C[C@@H]1c2cc(Cl)ccc2N[C@@H]1C |
| InChI | InChI=1S/C10H12ClN/c1-6-7(2)12-10-4-3-8(11)5-9(6)10/h3-7,12H,1-2H3/t6-,7+/m0/s1 |
| InChIKey | VJKRICFDADRTNJ-NKWVEPMBSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |