C10H12FN — CID 170593238
(3S)-5-fluoro-2,3-dimethyl-2,3-dihydro-1H-indole (PubChem CID 170593238) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (3S)-5-fluoro-2,3-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | (3S)-5-fluoro-2,3-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 170593238 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (3S)-5-fluoro-2,3-dimethyl-2,3-dihydro-1H-indole |
| SMILES | CC1Nc2ccc(F)cc2[C@@H]1C |
| InChI | InChI=1S/C10H12FN/c1-6-7(2)12-10-4-3-8(11)5-9(6)10/h3-7,12H,1-2H3/t6-,7?/m1/s1 |
| InChIKey | FTPWFFDMJLLGQU-ULUSZKPHSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |